About 3-methoxyphenoxathiine
3-methoxyphenoxathiine (PubChem CID 18687730) has the molecular formula C13H10O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-methoxyphenoxathiine.
Molecular Properties
| Compound Name | 3-methoxyphenoxathiine |
| PubChem CID | 18687730 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3-methoxyphenoxathiine |
| SMILES | COc1ccc2c(c1)Oc1ccccc1S2 |
| InChI | InChI=1S/C13H10O2S/c1-14-9-6-7-13-11(8-9)15-10-4-2-3-5-12(10)16-13/h2-8H,1H3 |
| InChIKey | IYSCKEWZEWNWQL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxyphenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyphenoxathiine?
The IUPAC name of 3-methoxyphenoxathiine (CID 18687730) is 3-methoxyphenoxathiine.
What is the SMILES notation for 3-methoxyphenoxathiine?
The canonical SMILES for 3-methoxyphenoxathiine is COc1ccc2c(c1)Oc1ccccc1S2.
What is the InChIKey of 3-methoxyphenoxathiine?
The InChIKey is IYSCKEWZEWNWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S/c1-14-9-6-7-13-11(8-9)15-10-4-2-3-5-12(10)16-13/h2-8H,1H3.
What are the key properties of 3-methoxyphenoxathiine?
3-methoxyphenoxathiine has a molecular weight of 230.29 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyphenoxathiine is sourced from PubChem (CID 18687730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).