About CID 18688288
CID 18688288 (PubChem CID 18688288) has the molecular formula C20H19Si
and a molecular weight of 287.46 g/mol.
Molecular Properties
| Compound Name | CID 18688288 |
| PubChem CID | 18688288 |
| Molecular Formula | C20H19Si |
| Molecular Weight | 287.46 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | — |
| SMILES | CC[Si](C1C=Cc2ccccc21)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C20H19Si/c1-2-21(19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20/h3-14,19-20H,2H2,1H3 |
| InChIKey | XCOKMEWMLJORFV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18688288 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18688288?
The IUPAC name of CID 18688288 (CID 18688288) is not available.
What is the SMILES notation for CID 18688288?
The canonical SMILES for CID 18688288 is CC[Si](C1C=Cc2ccccc21)C1C=Cc2ccccc21.
What is the InChIKey of CID 18688288?
The InChIKey is XCOKMEWMLJORFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Si/c1-2-21(19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20/h3-14,19-20H,2H2,1H3.
What are the key properties of CID 18688288?
CID 18688288 has a molecular weight of 287.46 g/mol, XLogP of 5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18688288 is sourced from PubChem (CID 18688288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).