About diiodozirconium(2+);methanidylbenzene
diiodozirconium(2+);methanidylbenzene (PubChem CID 18688471) has the molecular formula C14H14I2Zr
and a molecular weight of 527.30 g/mol. Its IUPAC name is diiodozirconium(2+);methanidylbenzene.
Molecular Properties
| Compound Name | diiodozirconium(2+);methanidylbenzene |
| PubChem CID | 18688471 |
| Molecular Formula | C14H14I2Zr |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 525.82 |
| IUPAC Name | diiodozirconium(2+);methanidylbenzene |
| SMILES | I[Zr+2]I.[CH2-]c1ccccc1.[CH2-]c1ccccc1 |
| InChI | InChI=1S/2C7H7.2HI.Zr/c2*1-7-5-3-2-4-6-7;;;/h2*2-6H,1H2;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | KASACAQAHWCCRF-UHFFFAOYSA-L |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diiodozirconium(2+);methanidylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodozirconium(2+);methanidylbenzene?
The IUPAC name of diiodozirconium(2+);methanidylbenzene (CID 18688471) is diiodozirconium(2+);methanidylbenzene.
What is the SMILES notation for diiodozirconium(2+);methanidylbenzene?
The canonical SMILES for diiodozirconium(2+);methanidylbenzene is I[Zr+2]I.[CH2-]c1ccccc1.[CH2-]c1ccccc1.
What is the InChIKey of diiodozirconium(2+);methanidylbenzene?
The InChIKey is KASACAQAHWCCRF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H7.2HI.Zr/c2*1-7-5-3-2-4-6-7;;;/h2*2-6H,1H2;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of diiodozirconium(2+);methanidylbenzene?
diiodozirconium(2+);methanidylbenzene has a molecular weight of 527.30 g/mol, XLogP of 5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diiodozirconium(2+);methanidylbenzene is sourced from PubChem (CID 18688471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).