About 1-acetyloxybut-1-enyl acetate
1-acetyloxybut-1-enyl acetate (PubChem CID 18688720) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-acetyloxybut-1-enyl acetate.
Molecular Properties
| Compound Name | 1-acetyloxybut-1-enyl acetate |
| PubChem CID | 18688720 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-acetyloxybut-1-enyl acetate |
| SMILES | CCC=C(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C8H12O4/c1-4-5-8(11-6(2)9)12-7(3)10/h5H,4H2,1-3H3 |
| InChIKey | LMNKSQUFMGNXAW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyloxybut-1-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyloxybut-1-enyl acetate?
The IUPAC name of 1-acetyloxybut-1-enyl acetate (CID 18688720) is 1-acetyloxybut-1-enyl acetate.
What is the SMILES notation for 1-acetyloxybut-1-enyl acetate?
The canonical SMILES for 1-acetyloxybut-1-enyl acetate is CCC=C(OC(C)=O)OC(C)=O.
What is the InChIKey of 1-acetyloxybut-1-enyl acetate?
The InChIKey is LMNKSQUFMGNXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-4-5-8(11-6(2)9)12-7(3)10/h5H,4H2,1-3H3.
What are the key properties of 1-acetyloxybut-1-enyl acetate?
1-acetyloxybut-1-enyl acetate has a molecular weight of 172.18 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyloxybut-1-enyl acetate is sourced from PubChem (CID 18688720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).