C23H40O — CID 18689037
1-[(2E,4E)-hexa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane (PubChem CID 18689037) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is 1-[(2E,4E)-hexa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane.
| Compound Name | 1-[(2E,4E)-hexa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 18689037 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 1-[(2E,4E)-hexa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane |
| SMILES | C/C=C/C=C/COC1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C23H40O/c1-3-5-7-9-19-24-23-17-15-22(16-18-23)21-13-11-20(12-14-21)10-8-6-4-2/h3,5,7,9,20-23H,4,6,8,10-19H2,1-2H3/b5-3+,9-7+ |
| InChIKey | QRIHBDSFZSMSBU-WJDMQLPWSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|