C25H44O — CID 18689040
1-heptyl-4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexane (PubChem CID 18689040) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-heptyl-4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexane.
| Compound Name | 1-heptyl-4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 18689040 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 1-heptyl-4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexane |
| SMILES | C/C=C/C=C/COC1CCC(C2CCC(CCCCCCC)CC2)CC1 |
| InChI | InChI=1S/C25H44O/c1-3-5-7-9-10-12-22-13-15-23(16-14-22)24-17-19-25(20-18-24)26-21-11-8-6-4-2/h4,6,8,11,22-25H,3,5,7,9-10,12-21H2,1-2H3/b6-4+,11-8+ |
| InChIKey | VLMJDUHUWYCFSE-JRRWEWNMSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|