About 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane
1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane (PubChem CID 18689106) has the molecular formula C25H44O
and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane.
Molecular Properties
| Compound Name | 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane |
| PubChem CID | 18689106 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane |
| SMILES | CCC/C=C/C=C/COC1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C25H44O/c1-3-5-7-8-9-11-21-26-25-19-17-24(18-20-25)23-15-13-22(14-16-23)12-10-6-4-2/h7-9,11,22-25H,3-6,10,12-21H2,1-2H3/b8-7+,11-9+ |
| InChIKey | NZHSGKOYLWQRFT-MFDVASPDSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane?
The IUPAC name of 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane (CID 18689106) is 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane.
What is the SMILES notation for 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane?
The canonical SMILES for 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane is CCC/C=C/C=C/COC1CCC(C2CCC(CCCCC)CC2)CC1.
What is the InChIKey of 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane?
The InChIKey is NZHSGKOYLWQRFT-MFDVASPDSA-N. The full InChI is InChI=1S/C25H44O/c1-3-5-7-8-9-11-21-26-25-19-17-24(18-20-25)23-15-13-22(14-16-23)12-10-6-4-2/h7-9,11,22-25H,3-6,10,12-21H2,1-2H3/b8-7+,11-9+.
What are the key properties of 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane?
1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane has a molecular weight of 360.63 g/mol, XLogP of 7.86, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E,4E)-octa-2,4-dienoxy]-4-(4-pentylcyclohexyl)cyclohexane is sourced from PubChem (CID 18689106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).