C17H30O — CID 18689165
1-[(2E,4E)-hexa-2,4-dienoxy]-4-pentylcyclohexane (PubChem CID 18689165) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-[(2E,4E)-hexa-2,4-dienoxy]-4-pentylcyclohexane.
| Compound Name | 1-[(2E,4E)-hexa-2,4-dienoxy]-4-pentylcyclohexane |
|---|---|
| PubChem CID | 18689165 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1-[(2E,4E)-hexa-2,4-dienoxy]-4-pentylcyclohexane |
| SMILES | C/C=C/C=C/COC1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C17H30O/c1-3-5-7-9-15-18-17-13-11-16(12-14-17)10-8-6-4-2/h3,5,7,9,16-17H,4,6,8,10-15H2,1-2H3/b5-3+,9-7+ |
| InChIKey | TWNXKSKUYHDXNO-WJDMQLPWSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|