C19H23F3O — CID 18689199
1-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]-4-(trifluoromethyl)benzene (PubChem CID 18689199) has the molecular formula C19H23F3O and a molecular weight of 324.39 g/mol. Its IUPAC name is 1-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 18689199 |
| Molecular Formula | C19H23F3O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]-4-(trifluoromethyl)benzene |
| SMILES | C/C=C/C=C/COC1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H23F3O/c1-2-3-4-5-14-23-18-12-8-16(9-13-18)15-6-10-17(11-7-15)19(20,21)22/h2-7,10-11,16,18H,8-9,12-14H2,1H3/b3-2+,5-4+ |
| InChIKey | WWNMHEPUCIZUDA-MQQKCMAXSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|