C18H21F3O — CID 18689234
1,2,3-trifluoro-5-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]benzene (PubChem CID 18689234) has the molecular formula C18H21F3O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]benzene |
|---|---|
| PubChem CID | 18689234 |
| Molecular Formula | C18H21F3O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]benzene |
| SMILES | C/C=C/C=C/COC1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H21F3O/c1-2-3-4-5-10-22-15-8-6-13(7-9-15)14-11-16(19)18(21)17(20)12-14/h2-5,11-13,15H,6-10H2,1H3/b3-2+,5-4+ |
| InChIKey | HTKJCYAQIBBFFS-MQQKCMAXSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|