C36H36N4O5 — CID 18689598
4-[[[2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]acetyl]amino]methyl]benzoic acid (PubChem CID 18689598) has the molecular formula C36H36N4O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is 4-[[[2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]acetyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 18689598 |
| Molecular Formula | C36H36N4O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 4-[[[2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]acetyl]amino]methyl]benzoic acid |
| SMILES | N#Cc1ccc(C(C(=O)NCc2ccc(C(=O)O)cc2)N2C(=O)C3Cc4ccccc4CN3C(=O)C2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C36H36N4O5/c37-20-24-10-14-26(15-11-24)32(33(41)38-21-25-12-16-27(17-13-25)36(44)45)40-31(18-23-6-2-1-3-7-23)34(42)39-22-29-9-5-4-8-28(29)19-30(39)35(40)43/h4-5,8-17,23,30-32H,1-3,6-7,18-19,21-22H2,(H,38,41)(H,44,45) |
| InChIKey | OUPMNVRBTDPZKP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |