About 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole
2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 18689703) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole |
| PubChem CID | 18689703 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | COc1cccc(CCc2cc(C)ccc2C2=NC(C)(C)CO2)c1 |
| InChI | InChI=1S/C21H25NO2/c1-15-8-11-19(20-22-21(2,3)14-24-20)17(12-15)10-9-16-6-5-7-18(13-16)23-4/h5-8,11-13H,9-10,14H2,1-4H3 |
| InChIKey | YXPGZZJLZWLUQG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole (CID 18689703) is 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole is COc1cccc(CCc2cc(C)ccc2C2=NC(C)(C)CO2)c1.
What is the InChIKey of 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is YXPGZZJLZWLUQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-15-8-11-19(20-22-21(2,3)14-24-20)17(12-15)10-9-16-6-5-7-18(13-16)23-4/h5-8,11-13H,9-10,14H2,1-4H3.
What are the key properties of 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole?
2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 323.44 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(3-methoxyphenyl)ethyl]-4-methylphenyl]-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 18689703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).