C13H11F6NO4S — CID 18690038
[7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 18690038) has the molecular formula C13H11F6NO4S and a molecular weight of 391.29 g/mol. Its IUPAC name is [7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18690038 |
| Molecular Formula | C13H11F6NO4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | [7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C(NC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C13H11F6NO4S/c14-12(15,16)11(21)20-9-3-1-7-2-4-10(6-8(7)5-9)24-25(22,23)13(17,18)19/h2,4,6,9H,1,3,5H2,(H,20,21) |
| InChIKey | DROFQWRQKARXBJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|