About N,N-dibutylbutan-1-amine;sulfuric acid
N,N-dibutylbutan-1-amine;sulfuric acid (PubChem CID 18690257) has the molecular formula C12H29NO4S
and a molecular weight of 283.43 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;sulfuric acid.
Molecular Properties
| Compound Name | N,N-dibutylbutan-1-amine;sulfuric acid |
| PubChem CID | 18690257 |
| Molecular Formula | C12H29NO4S |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N,N-dibutylbutan-1-amine;sulfuric acid |
| SMILES | CCCCN(CCCC)CCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C12H27N.H2O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | BPEQZXOPABVVLH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutylbutan-1-amine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbutan-1-amine;sulfuric acid?
The IUPAC name of N,N-dibutylbutan-1-amine;sulfuric acid (CID 18690257) is N,N-dibutylbutan-1-amine;sulfuric acid.
What is the SMILES notation for N,N-dibutylbutan-1-amine;sulfuric acid?
The canonical SMILES for N,N-dibutylbutan-1-amine;sulfuric acid is CCCCN(CCCC)CCCC.O=S(=O)(O)O.
What is the InChIKey of N,N-dibutylbutan-1-amine;sulfuric acid?
The InChIKey is BPEQZXOPABVVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.H2O4S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12H2,1-3H3;(H2,1,2,3,4).
What are the key properties of N,N-dibutylbutan-1-amine;sulfuric acid?
N,N-dibutylbutan-1-amine;sulfuric acid has a molecular weight of 283.43 g/mol, XLogP of 3.04, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbutan-1-amine;sulfuric acid is sourced from PubChem (CID 18690257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).