About 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide
2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide (PubChem CID 18690297) has the molecular formula C13H24N2O5
and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide |
| PubChem CID | 18690297 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide |
| SMILES | C=C(CO)C(N)=O.C=CC(N)=O.CC(C)=O.CC(C)=O |
| InChI | InChI=1S/C4H7NO2.C3H5NO.2C3H6O/c1-3(2-6)4(5)7;1-2-3(4)5;2*1-3(2)4/h6H,1-2H2,(H2,5,7);2H,1H2,(H2,4,5);2*1-2H3 |
| InChIKey | LQBNNDHZLYKCMF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide?
The IUPAC name of 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide (CID 18690297) is 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide.
What is the SMILES notation for 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide?
The canonical SMILES for 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide is C=C(CO)C(N)=O.C=CC(N)=O.CC(C)=O.CC(C)=O.
What is the InChIKey of 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide?
The InChIKey is LQBNNDHZLYKCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.C3H5NO.2C3H6O/c1-3(2-6)4(5)7;1-2-3(4)5;2*1-3(2)4/h6H,1-2H2,(H2,5,7);2H,1H2,(H2,4,5);2*1-2H3.
What are the key properties of 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide?
2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide has a molecular weight of 288.34 g/mol, XLogP of -0.13, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)prop-2-enamide;bis(propan-2-one);prop-2-enamide is sourced from PubChem (CID 18690297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).