oxolane-3,4-dicarboxylic acid

C6H8O5 — CID 18690328

IUPACoxolane-3,4-dicarboxylic acid
SMILESO=C(O)C1COCC1C(=O)O
InChIInChI=1S/C6H8O5/c7-5(8)3-1-11-2-4(3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)
InChIKeyQUHAOMPZQHGTKN-UHFFFAOYSA-N
MW160.12 g/mol
LogP-0.58
Rot. Bonds2

About oxolane-3,4-dicarboxylic acid

oxolane-3,4-dicarboxylic acid (PubChem CID 18690328) has the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. Its IUPAC name is oxolane-3,4-dicarboxylic acid.

Molecular Properties

Compound Nameoxolane-3,4-dicarboxylic acid
PubChem CID18690328
Molecular FormulaC6H8O5
Molecular Weight160.12 g/mol
Exact Mass160.04
IUPAC Nameoxolane-3,4-dicarboxylic acid
SMILESO=C(O)C1COCC1C(=O)O
InChIInChI=1S/C6H8O5/c7-5(8)3-1-11-2-4(3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)
InChIKeyQUHAOMPZQHGTKN-UHFFFAOYSA-N
XLogP-0.58
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.12
LogP ≤ 5-0.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze oxolane-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxolane-3,4-dicarboxylic acid?
The IUPAC name of oxolane-3,4-dicarboxylic acid (CID 18690328) is oxolane-3,4-dicarboxylic acid.
What is the SMILES notation for oxolane-3,4-dicarboxylic acid?
The canonical SMILES for oxolane-3,4-dicarboxylic acid is O=C(O)C1COCC1C(=O)O.
What is the InChIKey of oxolane-3,4-dicarboxylic acid?
The InChIKey is QUHAOMPZQHGTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5/c7-5(8)3-1-11-2-4(3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10).
What are the key properties of oxolane-3,4-dicarboxylic acid?
oxolane-3,4-dicarboxylic acid has a molecular weight of 160.12 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane-3,4-dicarboxylic acid is sourced from PubChem (CID 18690328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).