About 4-diazofluorene
4-diazofluorene (PubChem CID 18690529) has the molecular formula C13H8N2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-diazofluorene.
Molecular Properties
| Compound Name | 4-diazofluorene |
| PubChem CID | 18690529 |
| Molecular Formula | C13H8N2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-diazofluorene |
| SMILES | [N-]=[N+]=C1C=CC=C2C=c3ccccc3=C21 |
| InChI | InChI=1S/C13H8N2/c14-15-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-8H |
| InChIKey | AYMGKUFCRFMCQY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazofluorene?
The IUPAC name of 4-diazofluorene (CID 18690529) is 4-diazofluorene.
What is the SMILES notation for 4-diazofluorene?
The canonical SMILES for 4-diazofluorene is [N-]=[N+]=C1C=CC=C2C=c3ccccc3=C21.
What is the InChIKey of 4-diazofluorene?
The InChIKey is AYMGKUFCRFMCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2/c14-15-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-8H.
What are the key properties of 4-diazofluorene?
4-diazofluorene has a molecular weight of 192.22 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazofluorene is sourced from PubChem (CID 18690529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).