About 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one
8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 18690864) has the molecular formula C14H9F3N2O
and a molecular weight of 278.23 g/mol. Its IUPAC name is 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
Molecular Properties
| Compound Name | 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| PubChem CID | 18690864 |
| Molecular Formula | C14H9F3N2O |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2ccccc2Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H9F3N2O/c15-14(16,17)8-5-6-10-9(7-8)13(20)19-12-4-2-1-3-11(12)18-10/h1-7,18H,(H,19,20) |
| InChIKey | MDCSKDAPXHDHRW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The IUPAC name of 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CID 18690864) is 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
What is the SMILES notation for 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The canonical SMILES for 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one is O=C1Nc2ccccc2Nc2ccc(C(F)(F)F)cc21.
What is the InChIKey of 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The InChIKey is MDCSKDAPXHDHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N2O/c15-14(16,17)8-5-6-10-9(7-8)13(20)19-12-4-2-1-3-11(12)18-10/h1-7,18H,(H,19,20).
What are the key properties of 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one has a molecular weight of 278.23 g/mol, XLogP of 4.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(trifluoromethyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one is sourced from PubChem (CID 18690864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).