C30H28N6O3 — CID 18690894
2-[4-(2-benzyltetrazol-5-yl)phenyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 18690894) has the molecular formula C30H28N6O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-[4-(2-benzyltetrazol-5-yl)phenyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-[4-(2-benzyltetrazol-5-yl)phenyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 18690894 |
| Molecular Formula | C30H28N6O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 2-[4-(2-benzyltetrazol-5-yl)phenyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(c3ccc(-c4nnn(Cc5ccccc5)n4)cc3)C(=O)C3CC=CCC23)cc1OC |
| InChI | InChI=1S/C30H28N6O3/c1-38-26-17-14-22(18-27(26)39-2)28-24-10-6-7-11-25(24)30(37)36(32-28)23-15-12-21(13-16-23)29-31-34-35(33-29)19-20-8-4-3-5-9-20/h3-9,12-18,24-25H,10-11,19H2,1-2H3 |
| InChIKey | IBNSOYQJSDETNI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|