About 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine
9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine (PubChem CID 18691101) has the molecular formula C19H17N3O
and a molecular weight of 303.37 g/mol. Its IUPAC name is 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine.
Molecular Properties
| Compound Name | 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine |
| PubChem CID | 18691101 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine |
| SMILES | COc1ccc2ccn3c(N)c(-c4ccccc4C)nc3c2c1 |
| InChI | InChI=1S/C19H17N3O/c1-12-5-3-4-6-15(12)17-18(20)22-10-9-13-7-8-14(23-2)11-16(13)19(22)21-17/h3-11H,20H2,1-2H3 |
| InChIKey | YMWQEOYLTQCJLC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine?
The IUPAC name of 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine (CID 18691101) is 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine.
What is the SMILES notation for 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine?
The canonical SMILES for 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine is COc1ccc2ccn3c(N)c(-c4ccccc4C)nc3c2c1.
What is the InChIKey of 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine?
The InChIKey is YMWQEOYLTQCJLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O/c1-12-5-3-4-6-15(12)17-18(20)22-10-9-13-7-8-14(23-2)11-16(13)19(22)21-17/h3-11H,20H2,1-2H3.
What are the key properties of 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine?
9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine has a molecular weight of 303.37 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-2-(2-methylphenyl)imidazo[2,1-a]isoquinolin-3-amine is sourced from PubChem (CID 18691101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).