C15H13N3OS — CID 18691230
4-(2,5-dimethylthiophen-3-yl)-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-amine (PubChem CID 18691230) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-amine.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-amine |
|---|---|
| PubChem CID | 18691230 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-10-oxa-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-amine |
| SMILES | Cc1cc(-c2nc3c4ccoc4ccn3c2N)c(C)s1 |
| InChI | InChI=1S/C15H13N3OS/c1-8-7-11(9(2)20-8)13-14(16)18-5-3-12-10(4-6-19-12)15(18)17-13/h3-7H,16H2,1-2H3 |
| InChIKey | LRIZXUQKYAKCBC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |