About N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine
N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine (PubChem CID 18691311) has the molecular formula C22H24BrN3O3
and a molecular weight of 458.36 g/mol. Its IUPAC name is N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine |
| PubChem CID | 18691311 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine |
| SMILES | CCN(c1nc(C)cc(-c2ccccc2OC)n1)c1c(Br)cc(OC)cc1OC |
| InChI | InChI=1S/C22H24BrN3O3/c1-6-26(21-17(23)12-15(27-3)13-20(21)29-5)22-24-14(2)11-18(25-22)16-9-7-8-10-19(16)28-4/h7-13H,6H2,1-5H3 |
| InChIKey | BLZURCDEJGRCOY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine?
The IUPAC name of N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine (CID 18691311) is N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine.
What is the SMILES notation for N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine?
The canonical SMILES for N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine is CCN(c1nc(C)cc(-c2ccccc2OC)n1)c1c(Br)cc(OC)cc1OC.
What is the InChIKey of N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine?
The InChIKey is BLZURCDEJGRCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BrN3O3/c1-6-26(21-17(23)12-15(27-3)13-20(21)29-5)22-24-14(2)11-18(25-22)16-9-7-8-10-19(16)28-4/h7-13H,6H2,1-5H3.
What are the key properties of N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine?
N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine has a molecular weight of 458.36 g/mol, XLogP of 5.40, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-4,6-dimethoxyphenyl)-N-ethyl-4-(2-methoxyphenyl)-6-methylpyrimidin-2-amine is sourced from PubChem (CID 18691311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).