About (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate
(Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate (PubChem CID 18691441) has the molecular formula C15H12F2NO2S-
and a molecular weight of 308.33 g/mol. Its IUPAC name is (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate.
Molecular Properties
| Compound Name | (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate |
| PubChem CID | 18691441 |
| Molecular Formula | C15H12F2NO2S- |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate |
| SMILES | NC(C/C=C(\c1ccsc1)c1ccc(F)cc1F)C(=O)[O-] |
| InChI | InChI=1S/C15H13F2NO2S/c16-10-1-2-12(13(17)7-10)11(9-5-6-21-8-9)3-4-14(18)15(19)20/h1-3,5-8,14H,4,18H2,(H,19,20)/p-1/b11-3+ |
| InChIKey | HZJDVLYSPPQMTL-QDEBKDIKSA-M |
| XLogP | 1.93 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate?
The IUPAC name of (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate (CID 18691441) is (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate.
What is the SMILES notation for (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate?
The canonical SMILES for (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate is NC(C/C=C(\c1ccsc1)c1ccc(F)cc1F)C(=O)[O-].
What is the InChIKey of (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate?
The InChIKey is HZJDVLYSPPQMTL-QDEBKDIKSA-M. The full InChI is InChI=1S/C15H13F2NO2S/c16-10-1-2-12(13(17)7-10)11(9-5-6-21-8-9)3-4-14(18)15(19)20/h1-3,5-8,14H,4,18H2,(H,19,20)/p-1/b11-3+.
What are the key properties of (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate?
(Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate has a molecular weight of 308.33 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate is sourced from PubChem (CID 18691441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).