C14H19BrClNO2S — CID 18691593
1-(4-bromo-1-benzothiophen-5-yl)-2-[2-(dimethylamino)ethoxy]ethanol;hydrochloride (PubChem CID 18691593) has the molecular formula C14H19BrClNO2S and a molecular weight of 380.74 g/mol. Its IUPAC name is 1-(4-bromo-1-benzothiophen-5-yl)-2-[2-(dimethylamino)ethoxy]ethanol;hydrochloride.
| Compound Name | 1-(4-bromo-1-benzothiophen-5-yl)-2-[2-(dimethylamino)ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 18691593 |
| Molecular Formula | C14H19BrClNO2S |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 1-(4-bromo-1-benzothiophen-5-yl)-2-[2-(dimethylamino)ethoxy]ethanol;hydrochloride |
| SMILES | CN(C)CCOCC(O)c1ccc2sccc2c1Br.Cl |
| InChI | InChI=1S/C14H18BrNO2S.ClH/c1-16(2)6-7-18-9-12(17)10-3-4-13-11(14(10)15)5-8-19-13;/h3-5,8,12,17H,6-7,9H2,1-2H3;1H |
| InChIKey | HVWWQVYJXJJKEY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|