C24H34O2 — CID 18691662
4-(6-ethyl-2,4,4,6,8-pentamethyl-3,5-dihydrochromen-2-yl)-2,6-dimethylphenol (PubChem CID 18691662) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 4-(6-ethyl-2,4,4,6,8-pentamethyl-3,5-dihydrochromen-2-yl)-2,6-dimethylphenol.
| Compound Name | 4-(6-ethyl-2,4,4,6,8-pentamethyl-3,5-dihydrochromen-2-yl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 18691662 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 4-(6-ethyl-2,4,4,6,8-pentamethyl-3,5-dihydrochromen-2-yl)-2,6-dimethylphenol |
| SMILES | CCC1(C)C=C(C)C2=C(C1)C(C)(C)CC(C)(c1cc(C)c(O)c(C)c1)O2 |
| InChI | InChI=1S/C24H34O2/c1-9-23(7)12-17(4)21-19(13-23)22(5,6)14-24(8,26-21)18-10-15(2)20(25)16(3)11-18/h10-12,25H,9,13-14H2,1-8H3 |
| InChIKey | YOEIHNWRNMDIDX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |