C44H86N4 — CID 18691670
1,2,2,6,6-pentamethyl-4-[1,1,1-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]piperidine (PubChem CID 18691670) has the molecular formula C44H86N4 and a molecular weight of 671.20 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[1,1,1-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[1,1,1-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]piperidine |
|---|---|
| PubChem CID | 18691670 |
| Molecular Formula | C44H86N4 |
| Molecular Weight | 671.20 g/mol |
| Exact Mass | 670.69 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[1,1,1-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]piperidine |
| SMILES | CCC(C1CC(C)(C)N(C)C(C)(C)C1)C(C1CC(C)(C)N(C)C(C)(C)C1)(C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C44H86N4/c1-22-35(31-23-36(2,3)45(18)37(4,5)24-31)44(32-25-38(6,7)46(19)39(8,9)26-32,33-27-40(10,11)47(20)41(12,13)28-33)34-29-42(14,15)48(21)43(16,17)30-34/h31-35H,22-30H2,1-21H3 |
| InChIKey | ASRLDIMTXXWUCR-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.20 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |