C23H11F15N2O2 — CID 18691975
4-[4-[4-amino-2,6-bis(trifluoromethyl)phenoxy]-3-(trifluoromethyl)phenoxy]-3,5-bis(trifluoromethyl)aniline (PubChem CID 18691975) has the molecular formula C23H11F15N2O2 and a molecular weight of 632.32 g/mol. Its IUPAC name is 4-[4-[4-amino-2,6-bis(trifluoromethyl)phenoxy]-3-(trifluoromethyl)phenoxy]-3,5-bis(trifluoromethyl)aniline.
| Compound Name | 4-[4-[4-amino-2,6-bis(trifluoromethyl)phenoxy]-3-(trifluoromethyl)phenoxy]-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 18691975 |
| Molecular Formula | C23H11F15N2O2 |
| Molecular Weight | 632.32 g/mol |
| Exact Mass | 632.06 |
| IUPAC Name | 4-[4-[4-amino-2,6-bis(trifluoromethyl)phenoxy]-3-(trifluoromethyl)phenoxy]-3,5-bis(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)c(Oc2ccc(Oc3c(C(F)(F)F)cc(N)cc3C(F)(F)F)c(C(F)(F)F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H11F15N2O2/c24-19(25,26)11-7-10(41-17-12(20(27,28)29)3-8(39)4-13(17)21(30,31)32)1-2-16(11)42-18-14(22(33,34)35)5-9(40)6-15(18)23(36,37)38/h1-7H,39-40H2 |
| InChIKey | GVAUPYOFKBCVHW-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.32 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|