C27H27NP2 — CID 18692483
1,1,3,3-tetraphenyl-1,3-bis(phosphanyl)propan-2-amine (PubChem CID 18692483) has the molecular formula C27H27NP2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 1,1,3,3-tetraphenyl-1,3-bis(phosphanyl)propan-2-amine.
| Compound Name | 1,1,3,3-tetraphenyl-1,3-bis(phosphanyl)propan-2-amine |
|---|---|
| PubChem CID | 18692483 |
| Molecular Formula | C27H27NP2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1,1,3,3-tetraphenyl-1,3-bis(phosphanyl)propan-2-amine |
| SMILES | NC(C(P)(c1ccccc1)c1ccccc1)C(P)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NP2/c28-25(26(29,21-13-5-1-6-14-21)22-15-7-2-8-16-22)27(30,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25H,28-30H2 |
| InChIKey | LSZNHMABXYGOTR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|