About [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone
[5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone (PubChem CID 18692535) has the molecular formula C18H13Cl4N3O2
and a molecular weight of 445.13 g/mol. Its IUPAC name is [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone.
Molecular Properties
| Compound Name | [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone |
| PubChem CID | 18692535 |
| Molecular Formula | C18H13Cl4N3O2 |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone |
| SMILES | CCOc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H13Cl4N3O2/c1-2-27-18-14(16(26)10-5-3-4-6-11(10)20)17(23)25(24-18)15-12(21)7-9(19)8-13(15)22/h3-8H,2,23H2,1H3 |
| InChIKey | PBCXMZNUOXTKKA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone?
The IUPAC name of [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone (CID 18692535) is [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone.
What is the SMILES notation for [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone?
The canonical SMILES for [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone is CCOc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1C(=O)c1ccccc1Cl.
What is the InChIKey of [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone?
The InChIKey is PBCXMZNUOXTKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl4N3O2/c1-2-27-18-14(16(26)10-5-3-4-6-11(10)20)17(23)25(24-18)15-12(21)7-9(19)8-13(15)22/h3-8H,2,23H2,1H3.
What are the key properties of [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone?
[5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone has a molecular weight of 445.13 g/mol, XLogP of 5.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-3-ethoxy-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]-(2-chlorophenyl)methanone is sourced from PubChem (CID 18692535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).