About bis(2-methylpropane-1-sulfonate);nickel(2+)
bis(2-methylpropane-1-sulfonate);nickel(2+) (PubChem CID 18692783) has the molecular formula C8H18NiO6S2
and a molecular weight of 333.05 g/mol. Its IUPAC name is bis(2-methylpropane-1-sulfonate);nickel(2+).
Molecular Properties
| Compound Name | bis(2-methylpropane-1-sulfonate);nickel(2+) |
| PubChem CID | 18692783 |
| Molecular Formula | C8H18NiO6S2 |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | bis(2-methylpropane-1-sulfonate);nickel(2+) |
| SMILES | CC(C)CS(=O)(=O)[O-].CC(C)CS(=O)(=O)[O-].[Ni+2] |
| InChI | InChI=1S/2C4H10O3S.Ni/c2*1-4(2)3-8(5,6)7;/h2*4H,3H2,1-2H3,(H,5,6,7);/q;;+2/p-2 |
| InChIKey | RYRBKDLBKOXYJX-UHFFFAOYSA-L |
| XLogP | 0.37 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropane-1-sulfonate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropane-1-sulfonate);nickel(2+)?
The IUPAC name of bis(2-methylpropane-1-sulfonate);nickel(2+) (CID 18692783) is bis(2-methylpropane-1-sulfonate);nickel(2+).
What is the SMILES notation for bis(2-methylpropane-1-sulfonate);nickel(2+)?
The canonical SMILES for bis(2-methylpropane-1-sulfonate);nickel(2+) is CC(C)CS(=O)(=O)[O-].CC(C)CS(=O)(=O)[O-].[Ni+2].
What is the InChIKey of bis(2-methylpropane-1-sulfonate);nickel(2+)?
The InChIKey is RYRBKDLBKOXYJX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H10O3S.Ni/c2*1-4(2)3-8(5,6)7;/h2*4H,3H2,1-2H3,(H,5,6,7);/q;;+2/p-2.
What are the key properties of bis(2-methylpropane-1-sulfonate);nickel(2+)?
bis(2-methylpropane-1-sulfonate);nickel(2+) has a molecular weight of 333.05 g/mol, XLogP of 0.37, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropane-1-sulfonate);nickel(2+) is sourced from PubChem (CID 18692783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).