About cinnoline-4-carbaldehyde
cinnoline-4-carbaldehyde (PubChem CID 18692981) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is cinnoline-4-carbaldehyde.
Molecular Properties
| Compound Name | cinnoline-4-carbaldehyde |
| PubChem CID | 18692981 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | cinnoline-4-carbaldehyde |
| SMILES | O=Cc1cnnc2ccccc12 |
| InChI | InChI=1S/C9H6N2O/c12-6-7-5-10-11-9-4-2-1-3-8(7)9/h1-6H |
| InChIKey | CORTZCFBTFGJGU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cinnoline-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline-4-carbaldehyde?
The IUPAC name of cinnoline-4-carbaldehyde (CID 18692981) is cinnoline-4-carbaldehyde.
What is the SMILES notation for cinnoline-4-carbaldehyde?
The canonical SMILES for cinnoline-4-carbaldehyde is O=Cc1cnnc2ccccc12.
What is the InChIKey of cinnoline-4-carbaldehyde?
The InChIKey is CORTZCFBTFGJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c12-6-7-5-10-11-9-4-2-1-3-8(7)9/h1-6H.
What are the key properties of cinnoline-4-carbaldehyde?
cinnoline-4-carbaldehyde has a molecular weight of 158.16 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline-4-carbaldehyde is sourced from PubChem (CID 18692981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).