About 1-ethoxyethylbenzene
1-ethoxyethylbenzene (PubChem CID 18693) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-ethoxyethylbenzene.
Molecular Properties
| Compound Name | 1-ethoxyethylbenzene |
| PubChem CID | 18693 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1-ethoxyethylbenzene |
| SMILES | CCOC(C)c1ccccc1 |
| InChI | InChI=1S/C10H14O/c1-3-11-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| InChIKey | MVTKJCAAJPVUHJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethoxyethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethylbenzene?
The IUPAC name of 1-ethoxyethylbenzene (CID 18693) is 1-ethoxyethylbenzene.
What is the SMILES notation for 1-ethoxyethylbenzene?
The canonical SMILES for 1-ethoxyethylbenzene is CCOC(C)c1ccccc1.
What is the InChIKey of 1-ethoxyethylbenzene?
The InChIKey is MVTKJCAAJPVUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-11-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3.
What are the key properties of 1-ethoxyethylbenzene?
1-ethoxyethylbenzene has a molecular weight of 150.22 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethylbenzene is sourced from PubChem (CID 18693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).