About 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine
2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine (PubChem CID 18693329) has the molecular formula C21H21FN4O
and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine |
| PubChem CID | 18693329 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine |
| SMILES | C=C(c1ccc(-c2ccccc2)c(F)c1)c1cc(C/N=C(\N)N(C)C)on1 |
| InChI | InChI=1S/C21H21FN4O/c1-14(20-12-17(27-25-20)13-24-21(23)26(2)3)16-9-10-18(19(22)11-16)15-7-5-4-6-8-15/h4-12H,1,13H2,2-3H3,(H2,23,24) |
| InChIKey | BQFDCFGPTQJFBY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine?
The IUPAC name of 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine (CID 18693329) is 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine.
What is the SMILES notation for 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine?
The canonical SMILES for 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine is C=C(c1ccc(-c2ccccc2)c(F)c1)c1cc(C/N=C(\N)N(C)C)on1.
What is the InChIKey of 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine?
The InChIKey is BQFDCFGPTQJFBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FN4O/c1-14(20-12-17(27-25-20)13-24-21(23)26(2)3)16-9-10-18(19(22)11-16)15-7-5-4-6-8-15/h4-12H,1,13H2,2-3H3,(H2,23,24).
What are the key properties of 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine?
2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine has a molecular weight of 364.42 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[1-(3-fluoro-4-phenylphenyl)ethenyl]-1,2-oxazol-5-yl]methyl]-1,1-dimethylguanidine is sourced from PubChem (CID 18693329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).