C24H27FN4O2 — CID 18693353
N'-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]piperidine-1-carboximidamide (PubChem CID 18693353) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is N'-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]piperidine-1-carboximidamide.
| Compound Name | N'-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 18693353 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N'-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]piperidine-1-carboximidamide |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1onc(/N=C(\N)N2CCCCC2)c1CO |
| InChI | InChI=1S/C24H27FN4O2/c1-16(18-10-11-19(21(25)14-18)17-8-4-2-5-9-17)22-20(15-30)23(28-31-22)27-24(26)29-12-6-3-7-13-29/h2,4-5,8-11,14,16,30H,3,6-7,12-13,15H2,1H3,(H2,26,27,28) |
| InChIKey | RHOBBELOPAXUEN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|