C22H25FN4O2 — CID 18693359
2-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]methyl]-1,1-dimethylguanidine (PubChem CID 18693359) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]methyl]-1,1-dimethylguanidine.
| Compound Name | 2-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]methyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 18693359 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-4-(hydroxymethyl)-1,2-oxazol-3-yl]methyl]-1,1-dimethylguanidine |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1onc(C/N=C(\N)N(C)C)c1CO |
| InChI | InChI=1S/C22H25FN4O2/c1-14(16-9-10-17(19(23)11-16)15-7-5-4-6-8-15)21-18(13-28)20(26-29-21)12-25-22(24)27(2)3/h4-11,14,28H,12-13H2,1-3H3,(H2,24,25) |
| InChIKey | XUIRLHVZGNRYKN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|