C25H27FN4O3 — CID 18693394
2-[3-[[amino(piperidin-1-yl)methylidene]amino]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid (PubChem CID 18693394) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-[3-[[amino(piperidin-1-yl)methylidene]amino]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid.
| Compound Name | 2-[3-[[amino(piperidin-1-yl)methylidene]amino]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 18693394 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-[3-[[amino(piperidin-1-yl)methylidene]amino]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1onc(/N=C(\N)N2CCCCC2)c1CC(=O)O |
| InChI | InChI=1S/C25H27FN4O3/c1-16(18-10-11-19(21(26)14-18)17-8-4-2-5-9-17)23-20(15-22(31)32)24(29-33-23)28-25(27)30-12-6-3-7-13-30/h2,4-5,8-11,14,16H,3,6-7,12-13,15H2,1H3,(H,31,32)(H2,27,28,29) |
| InChIKey | OENZZZJFDMAGLE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|