About 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine
2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine (PubChem CID 18693398) has the molecular formula C20H22FN5O
and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine |
| PubChem CID | 18693398 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N/C(N)=N/CCN)no1 |
| InChI | InChI=1S/C20H22FN5O/c1-13(18-12-19(26-27-18)25-20(23)24-10-9-22)15-7-8-16(17(21)11-15)14-5-3-2-4-6-14/h2-8,11-13H,9-10,22H2,1H3,(H3,23,24,25,26) |
| InChIKey | CYJWPYFEJSVIOW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine?
The IUPAC name of 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine (CID 18693398) is 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine.
What is the SMILES notation for 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine?
The canonical SMILES for 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine is CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N/C(N)=N/CCN)no1.
What is the InChIKey of 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine?
The InChIKey is CYJWPYFEJSVIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN5O/c1-13(18-12-19(26-27-18)25-20(23)24-10-9-22)15-7-8-16(17(21)11-15)14-5-3-2-4-6-14/h2-8,11-13H,9-10,22H2,1H3,(H3,23,24,25,26).
What are the key properties of 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine?
2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine has a molecular weight of 367.43 g/mol, XLogP of 3.32, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]guanidine is sourced from PubChem (CID 18693398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).