About tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate
tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 18693401) has the molecular formula C13H25N3O4
and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| PubChem CID | 18693401 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | [H]/N=C(\N(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-12(2,3)19-10(17)16(9(14)15(7)8)11(18)20-13(4,5)6/h14H,1-8H3/b14-9+ |
| InChIKey | PFBIYOBZKKYWMI-NTEUORMPSA-N |
| XLogP | 2.65 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The IUPAC name of tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CID 18693401) is tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
What is the SMILES notation for tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The canonical SMILES for tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate is [H]/N=C(\N(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The InChIKey is PFBIYOBZKKYWMI-NTEUORMPSA-N. The full InChI is InChI=1S/C13H25N3O4/c1-12(2,3)19-10(17)16(9(14)15(7)8)11(18)20-13(4,5)6/h14H,1-8H3/b14-9+.
What are the key properties of tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate has a molecular weight of 287.36 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(N,N-dimethylcarbamimidoyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate is sourced from PubChem (CID 18693401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).