C25H28FN5O2 — CID 18693523
1-[N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]piperidine-3-carboxamide (PubChem CID 18693523) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-[N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]piperidine-3-carboxamide.
| Compound Name | 1-[N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 18693523 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-[N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]piperidine-3-carboxamide |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(C/N=C(\N)N2CCCC(C(N)=O)C2)on1 |
| InChI | InChI=1S/C25H28FN5O2/c1-16(18-9-10-21(22(26)12-18)17-6-3-2-4-7-17)23-13-20(33-30-23)14-29-25(28)31-11-5-8-19(15-31)24(27)32/h2-4,6-7,9-10,12-13,16,19H,5,8,11,14-15H2,1H3,(H2,27,32)(H2,28,29) |
| InChIKey | UVNTZGSPRJQWTK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|