About 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine
1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine (PubChem CID 18693583) has the molecular formula C23H27FN4O
and a molecular weight of 394.49 g/mol. Its IUPAC name is 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine.
Molecular Properties
| Compound Name | 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine |
| PubChem CID | 18693583 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine |
| SMILES | CCN(CC)/C(N)=N/c1cc(C(C)(C)c2ccc(-c3ccccc3F)cc2)no1 |
| InChI | InChI=1S/C23H27FN4O/c1-5-28(6-2)22(25)26-21-15-20(27-29-21)23(3,4)17-13-11-16(12-14-17)18-9-7-8-10-19(18)24/h7-15H,5-6H2,1-4H3,(H2,25,26) |
| InChIKey | AIWHBZAIVBDVOV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine?
The IUPAC name of 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine (CID 18693583) is 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine.
What is the SMILES notation for 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine?
The canonical SMILES for 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine is CCN(CC)/C(N)=N/c1cc(C(C)(C)c2ccc(-c3ccccc3F)cc2)no1.
What is the InChIKey of 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine?
The InChIKey is AIWHBZAIVBDVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FN4O/c1-5-28(6-2)22(25)26-21-15-20(27-29-21)23(3,4)17-13-11-16(12-14-17)18-9-7-8-10-19(18)24/h7-15H,5-6H2,1-4H3,(H2,25,26).
What are the key properties of 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine?
1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine has a molecular weight of 394.49 g/mol, XLogP of 5.09, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethyl-2-[3-[2-[4-(2-fluorophenyl)phenyl]propan-2-yl]-1,2-oxazol-5-yl]guanidine is sourced from PubChem (CID 18693583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).