C23H23FN4O5 — CID 18693794
2-[[N'-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]carbamimidoyl]amino]butanedioic acid (PubChem CID 18693794) has the molecular formula C23H23FN4O5 and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-[[N'-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]carbamimidoyl]amino]butanedioic acid.
| Compound Name | 2-[[N'-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]carbamimidoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18693794 |
| Molecular Formula | C23H23FN4O5 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[[N'-[[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]carbamimidoyl]amino]butanedioic acid |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(C/N=C(\N)NC(CC(=O)O)C(=O)O)no1 |
| InChI | InChI=1S/C23H23FN4O5/c1-13(15-7-8-17(18(24)9-15)14-5-3-2-4-6-14)20-10-16(28-33-20)12-26-23(25)27-19(22(31)32)11-21(29)30/h2-10,13,19H,11-12H2,1H3,(H,29,30)(H,31,32)(H3,25,26,27) |
| InChIKey | BIMVHWQKDFVQGA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|