About (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate
(8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate (PubChem CID 18694175) has the molecular formula C19H17FO4S
and a molecular weight of 360.41 g/mol. Its IUPAC name is (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate |
| PubChem CID | 18694175 |
| Molecular Formula | C19H17FO4S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate |
| SMILES | C#Cc1cc(F)cc2c1OC(COS(=O)(=O)c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C19H17FO4S/c1-3-14-10-16(20)11-15-6-7-17(24-19(14)15)12-23-25(21,22)18-8-4-13(2)5-9-18/h1,4-5,8-11,17H,6-7,12H2,2H3 |
| InChIKey | LSXZAELPHVMNEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate?
The IUPAC name of (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate (CID 18694175) is (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate.
What is the SMILES notation for (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate?
The canonical SMILES for (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate is C#Cc1cc(F)cc2c1OC(COS(=O)(=O)c1ccc(C)cc1)CC2.
What is the InChIKey of (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate?
The InChIKey is LSXZAELPHVMNEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FO4S/c1-3-14-10-16(20)11-15-6-7-17(24-19(14)15)12-23-25(21,22)18-8-4-13(2)5-9-18/h1,4-5,8-11,17H,6-7,12H2,2H3.
What are the key properties of (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate?
(8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate has a molecular weight of 360.41 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-ethynyl-6-fluoro-3,4-dihydro-2H-chromen-2-yl)methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 18694175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).