C14H33N3 — CID 18694598
4-N-(2-aminoethyl)-3-N,3-N,3-triethylhexane-3,4-diamine (PubChem CID 18694598) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is 4-N-(2-aminoethyl)-3-N,3-N,3-triethylhexane-3,4-diamine.
| Compound Name | 4-N-(2-aminoethyl)-3-N,3-N,3-triethylhexane-3,4-diamine |
|---|---|
| PubChem CID | 18694598 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | 4-N-(2-aminoethyl)-3-N,3-N,3-triethylhexane-3,4-diamine |
| SMILES | CCC(NCCN)C(CC)(CC)N(CC)CC |
| InChI | InChI=1S/C14H33N3/c1-6-13(16-12-11-15)14(7-2,8-3)17(9-4)10-5/h13,16H,6-12,15H2,1-5H3 |
| InChIKey | ZIONWJXKNQBFPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |