C12H7F14NO2 — CID 18694739
2,2,3,3,4,4,4-heptafluoro-1-[5-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutyl)-1H-pyrrol-2-yl]butan-1-ol (PubChem CID 18694739) has the molecular formula C12H7F14NO2 and a molecular weight of 463.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[5-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutyl)-1H-pyrrol-2-yl]butan-1-ol.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[5-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutyl)-1H-pyrrol-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 18694739 |
| Molecular Formula | C12H7F14NO2 |
| Molecular Weight | 463.17 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[5-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutyl)-1H-pyrrol-2-yl]butan-1-ol |
| SMILES | OC(c1ccc(C(O)C(F)(F)C(F)(F)C(F)(F)F)[nH]1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F14NO2/c13-7(14,9(17,18)11(21,22)23)5(28)3-1-2-4(27-3)6(29)8(15,16)10(19,20)12(24,25)26/h1-2,5-6,27-29H |
| InChIKey | UVCRJLSPFRGCQD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.17 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|