About 1-amino-2H-azulene-1,3-dicarbonitrile
1-amino-2H-azulene-1,3-dicarbonitrile (PubChem CID 18694980) has the molecular formula C12H9N3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-amino-2H-azulene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 1-amino-2H-azulene-1,3-dicarbonitrile |
| PubChem CID | 18694980 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-amino-2H-azulene-1,3-dicarbonitrile |
| SMILES | N#CC1=C2C=CC=CC=C2C(N)(C#N)C1 |
| InChI | InChI=1S/C12H9N3/c13-7-9-6-12(15,8-14)11-5-3-1-2-4-10(9)11/h1-5H,6,15H2 |
| InChIKey | GCHTWLDYVZEMFF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-2H-azulene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2H-azulene-1,3-dicarbonitrile?
The IUPAC name of 1-amino-2H-azulene-1,3-dicarbonitrile (CID 18694980) is 1-amino-2H-azulene-1,3-dicarbonitrile.
What is the SMILES notation for 1-amino-2H-azulene-1,3-dicarbonitrile?
The canonical SMILES for 1-amino-2H-azulene-1,3-dicarbonitrile is N#CC1=C2C=CC=CC=C2C(N)(C#N)C1.
What is the InChIKey of 1-amino-2H-azulene-1,3-dicarbonitrile?
The InChIKey is GCHTWLDYVZEMFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3/c13-7-9-6-12(15,8-14)11-5-3-1-2-4-10(9)11/h1-5H,6,15H2.
What are the key properties of 1-amino-2H-azulene-1,3-dicarbonitrile?
1-amino-2H-azulene-1,3-dicarbonitrile has a molecular weight of 195.22 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2H-azulene-1,3-dicarbonitrile is sourced from PubChem (CID 18694980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).