About 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine
4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine (PubChem CID 18695013) has the molecular formula C32H31NO4
and a molecular weight of 493.60 g/mol. Its IUPAC name is 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine.
Molecular Properties
| Compound Name | 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine |
| PubChem CID | 18695013 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine |
| SMILES | COc1cc(OC)c2cc(C)c3c(c2c1)OC(c1ccccc1)(c1ccc(N2CCOCC2)cc1)C=C3 |
| InChI | InChI=1S/C32H31NO4/c1-22-19-28-29(20-26(34-2)21-30(28)35-3)31-27(22)13-14-32(37-31,23-7-5-4-6-8-23)24-9-11-25(12-10-24)33-15-17-36-18-16-33/h4-14,19-21H,15-18H2,1-3H3 |
| InChIKey | WMWOSZLXLPMVEA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine?
The IUPAC name of 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine (CID 18695013) is 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine.
What is the SMILES notation for 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine?
The canonical SMILES for 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine is COc1cc(OC)c2cc(C)c3c(c2c1)OC(c1ccccc1)(c1ccc(N2CCOCC2)cc1)C=C3.
What is the InChIKey of 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine?
The InChIKey is WMWOSZLXLPMVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H31NO4/c1-22-19-28-29(20-26(34-2)21-30(28)35-3)31-27(22)13-14-32(37-31,23-7-5-4-6-8-23)24-9-11-25(12-10-24)33-15-17-36-18-16-33/h4-14,19-21H,15-18H2,1-3H3.
What are the key properties of 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine?
4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine has a molecular weight of 493.60 g/mol, XLogP of 6.35, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(7,9-dimethoxy-5-methyl-2-phenylbenzo[h]chromen-2-yl)phenyl]morpholine is sourced from PubChem (CID 18695013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).