C33H62O6 — CID 18695211
2,6-bis(2,4,4-trimethylpentyl)-4-[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine (PubChem CID 18695211) has the molecular formula C33H62O6 and a molecular weight of 554.85 g/mol. Its IUPAC name is 2,6-bis(2,4,4-trimethylpentyl)-4-[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine.
| Compound Name | 2,6-bis(2,4,4-trimethylpentyl)-4-[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
|---|---|
| PubChem CID | 18695211 |
| Molecular Formula | C33H62O6 |
| Molecular Weight | 554.85 g/mol |
| Exact Mass | 554.45 |
| IUPAC Name | 2,6-bis(2,4,4-trimethylpentyl)-4-[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
| SMILES | CC(CC1OCC(C2OC(CC(C)CC(C)(C)C)OC3COC(CC(C)CC(C)(C)C)OC32)O1)CC(C)(C)C |
| InChI | InChI=1S/C33H62O6/c1-21(16-31(4,5)6)13-26-34-19-24(36-26)30-29-25(37-28(39-30)15-23(3)18-33(10,11)12)20-35-27(38-29)14-22(2)17-32(7,8)9/h21-30H,13-20H2,1-12H3 |
| InChIKey | UKPHRNMZNPRDQY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.85 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |