About 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide
3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide (PubChem CID 18696060) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide |
| PubChem CID | 18696060 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide |
| SMILES | NCCOc1noc2cccc(C(N)=O)c12 |
| InChI | InChI=1S/C10H11N3O3/c11-4-5-15-10-8-6(9(12)14)2-1-3-7(8)16-13-10/h1-3H,4-5,11H2,(H2,12,14) |
| InChIKey | NPTLWTPLLTXUDO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide?
The IUPAC name of 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide (CID 18696060) is 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide.
What is the SMILES notation for 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide?
The canonical SMILES for 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide is NCCOc1noc2cccc(C(N)=O)c12.
What is the InChIKey of 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide?
The InChIKey is NPTLWTPLLTXUDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3/c11-4-5-15-10-8-6(9(12)14)2-1-3-7(8)16-13-10/h1-3H,4-5,11H2,(H2,12,14).
What are the key properties of 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide?
3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide has a molecular weight of 221.22 g/mol, XLogP of 0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethoxy)-1,2-benzoxazole-4-carboxamide is sourced from PubChem (CID 18696060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).