About N-(2-aminoethoxy)-1,2-benzoxazol-3-amine
N-(2-aminoethoxy)-1,2-benzoxazol-3-amine (PubChem CID 18696093) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is N-(2-aminoethoxy)-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | N-(2-aminoethoxy)-1,2-benzoxazol-3-amine |
| PubChem CID | 18696093 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(2-aminoethoxy)-1,2-benzoxazol-3-amine |
| SMILES | NCCONc1noc2ccccc12 |
| InChI | InChI=1S/C9H11N3O2/c10-5-6-13-11-9-7-3-1-2-4-8(7)14-12-9/h1-4H,5-6,10H2,(H,11,12) |
| InChIKey | KLHVEGFWEXNNFB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethoxy)-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethoxy)-1,2-benzoxazol-3-amine?
The IUPAC name of N-(2-aminoethoxy)-1,2-benzoxazol-3-amine (CID 18696093) is N-(2-aminoethoxy)-1,2-benzoxazol-3-amine.
What is the SMILES notation for N-(2-aminoethoxy)-1,2-benzoxazol-3-amine?
The canonical SMILES for N-(2-aminoethoxy)-1,2-benzoxazol-3-amine is NCCONc1noc2ccccc12.
What is the InChIKey of N-(2-aminoethoxy)-1,2-benzoxazol-3-amine?
The InChIKey is KLHVEGFWEXNNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c10-5-6-13-11-9-7-3-1-2-4-8(7)14-12-9/h1-4H,5-6,10H2,(H,11,12).
What are the key properties of N-(2-aminoethoxy)-1,2-benzoxazol-3-amine?
N-(2-aminoethoxy)-1,2-benzoxazol-3-amine has a molecular weight of 193.21 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethoxy)-1,2-benzoxazol-3-amine is sourced from PubChem (CID 18696093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).