About 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride
2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride (PubChem CID 18696160) has the molecular formula C9H10Cl2N2OS
and a molecular weight of 265.16 g/mol. Its IUPAC name is 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride |
| PubChem CID | 18696160 |
| Molecular Formula | C9H10Cl2N2OS |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride |
| SMILES | Cl.NCCSc1noc2ccc(Cl)cc12 |
| InChI | InChI=1S/C9H9ClN2OS.ClH/c10-6-1-2-8-7(5-6)9(12-13-8)14-4-3-11;/h1-2,5H,3-4,11H2;1H |
| InChIKey | DFEQATHOJBJWOX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride?
The IUPAC name of 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride (CID 18696160) is 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride?
The canonical SMILES for 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride is Cl.NCCSc1noc2ccc(Cl)cc12.
What is the InChIKey of 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride?
The InChIKey is DFEQATHOJBJWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2OS.ClH/c10-6-1-2-8-7(5-6)9(12-13-8)14-4-3-11;/h1-2,5H,3-4,11H2;1H.
What are the key properties of 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride?
2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride has a molecular weight of 265.16 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,2-benzoxazol-3-yl)sulfanyl]ethanamine;hydrochloride is sourced from PubChem (CID 18696160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).